About bis(2-(4-chlorophenoxy)acetic acid);zinc
bis(2-(4-chlorophenoxy)acetic acid);zinc (PubChem CID 11201418) has the molecular formula C16H14Cl2O6Zn
and a molecular weight of 438.58 g/mol. Its IUPAC name is bis(2-(4-chlorophenoxy)acetic acid);zinc.
Molecular Properties
| Compound Name | bis(2-(4-chlorophenoxy)acetic acid);zinc |
| PubChem CID | 11201418 |
| Molecular Formula | C16H14Cl2O6Zn |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | bis(2-(4-chlorophenoxy)acetic acid);zinc |
| SMILES | O=C(O)COc1ccc(Cl)cc1.O=C(O)COc1ccc(Cl)cc1.[Zn] |
| InChI | InChI=1S/2C8H7ClO3.Zn/c2*9-6-1-3-7(4-2-6)12-5-8(10)11;/h2*1-4H,5H2,(H,10,11); |
| InChIKey | NSKMOGLZKMVRBH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(4-chlorophenoxy)acetic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(4-chlorophenoxy)acetic acid);zinc?
The IUPAC name of bis(2-(4-chlorophenoxy)acetic acid);zinc (CID 11201418) is bis(2-(4-chlorophenoxy)acetic acid);zinc.
What is the SMILES notation for bis(2-(4-chlorophenoxy)acetic acid);zinc?
The canonical SMILES for bis(2-(4-chlorophenoxy)acetic acid);zinc is O=C(O)COc1ccc(Cl)cc1.O=C(O)COc1ccc(Cl)cc1.[Zn].
What is the InChIKey of bis(2-(4-chlorophenoxy)acetic acid);zinc?
The InChIKey is NSKMOGLZKMVRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7ClO3.Zn/c2*9-6-1-3-7(4-2-6)12-5-8(10)11;/h2*1-4H,5H2,(H,10,11);.
What are the key properties of bis(2-(4-chlorophenoxy)acetic acid);zinc?
bis(2-(4-chlorophenoxy)acetic acid);zinc has a molecular weight of 438.58 g/mol, XLogP of 3.60, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(4-chlorophenoxy)acetic acid);zinc is sourced from PubChem (CID 11201418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).