About 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate
2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate (PubChem CID 174896750) has the molecular formula C16H13Cl2FO5
and a molecular weight of 375.18 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate |
| PubChem CID | 174896750 |
| Molecular Formula | C16H13Cl2FO5 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate |
| SMILES | O=C(CF)Oc1ccc(Cl)cc1.O=C(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6ClFO2.C8H7ClO3/c9-6-1-3-7(4-2-6)12-8(11)5-10;9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2;1-4H,5H2,(H,10,11) |
| InChIKey | SCXYRVPWJHLXDM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate?
The IUPAC name of 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate (CID 174896750) is 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate.
What is the SMILES notation for 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate?
The canonical SMILES for 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate is O=C(CF)Oc1ccc(Cl)cc1.O=C(O)COc1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate?
The InChIKey is SCXYRVPWJHLXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFO2.C8H7ClO3/c9-6-1-3-7(4-2-6)12-8(11)5-10;9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2;1-4H,5H2,(H,10,11).
What are the key properties of 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate?
2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate has a molecular weight of 375.18 g/mol, XLogP of 4.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)acetic acid;(4-chlorophenyl) 2-fluoroacetate is sourced from PubChem (CID 174896750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).