About 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane
2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane (PubChem CID 174737533) has the molecular formula C12H19ClO3Sn
and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane |
| PubChem CID | 174737533 |
| Molecular Formula | C12H19ClO3Sn |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane |
| SMILES | CC[SnH](C)C.O=C(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClO3.C2H5.2CH3.Sn.H/c9-6-1-3-7(4-2-6)12-5-8(10)11;1-2;;;;/h1-4H,5H2,(H,10,11);1H2,2H3;2*1H3;; |
| InChIKey | MXROACOYMRUCDQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane?
The IUPAC name of 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane (CID 174737533) is 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane.
What is the SMILES notation for 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane?
The canonical SMILES for 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane is CC[SnH](C)C.O=C(O)COc1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane?
The InChIKey is MXROACOYMRUCDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO3.C2H5.2CH3.Sn.H/c9-6-1-3-7(4-2-6)12-5-8(10)11;1-2;;;;/h1-4H,5H2,(H,10,11);1H2,2H3;2*1H3;;.
What are the key properties of 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane?
2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane has a molecular weight of 365.45 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)acetic acid;ethyl(dimethyl)stannane is sourced from PubChem (CID 174737533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).