C12H17Cl2NO3 — CID 159778479
2-chloro-N,N-dimethylethanamine;2-(4-chlorophenoxy)acetic acid (PubChem CID 159778479) has the molecular formula C12H17Cl2NO3 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine;2-(4-chlorophenoxy)acetic acid.
| Compound Name | 2-chloro-N,N-dimethylethanamine;2-(4-chlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 159778479 |
| Molecular Formula | C12H17Cl2NO3 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine;2-(4-chlorophenoxy)acetic acid |
| SMILES | CN(C)CCCl.O=C(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClO3.C4H10ClN/c9-6-1-3-7(4-2-6)12-5-8(10)11;1-6(2)4-3-5/h1-4H,5H2,(H,10,11);3-4H2,1-2H3 |
| InChIKey | NHAXQXDIBDBILS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|