About ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine
ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine (PubChem CID 170598336) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine.
Molecular Properties
| Compound Name | ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine |
| PubChem CID | 170598336 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine |
| SMILES | CC.CCCN.Cc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C9H10O3.C3H9N.C2H6/c1-7-2-4-8(5-3-7)12-6-9(10)11;1-2-3-4;1-2/h2-5H,6H2,1H3,(H,10,11);2-4H2,1H3;1-2H3 |
| InChIKey | LMKKXVDTHIEMAX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine?
The IUPAC name of ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine (CID 170598336) is ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine.
What is the SMILES notation for ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine?
The canonical SMILES for ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine is CC.CCCN.Cc1ccc(OCC(=O)O)cc1.
What is the InChIKey of ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine?
The InChIKey is LMKKXVDTHIEMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C3H9N.C2H6/c1-7-2-4-8(5-3-7)12-6-9(10)11;1-2-3-4;1-2/h2-5H,6H2,1H3,(H,10,11);2-4H2,1H3;1-2H3.
What are the key properties of ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine?
ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine has a molecular weight of 255.36 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methylphenoxy)acetic acid;propan-1-amine is sourced from PubChem (CID 170598336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).