2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid

C16H16O3 — CID 66680223

IUPAC2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid
SMILESCc1cc(C)cc(-c2ccc(OCC(=O)O)cc2)c1
InChIInChI=1S/C16H16O3/c1-11-7-12(2)9-14(8-11)13-3-5-15(6-4-13)19-10-16(17)18/h3-9H,10H2,1-2H3,(H,17,18)
InChIKeyZCIWMAAGTHMUAZ-UHFFFAOYSA-N
MW256.30 g/mol
LogP3.43
Rot. Bonds4

About 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid

2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid (PubChem CID 66680223) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid
PubChem CID66680223
Molecular FormulaC16H16O3
Molecular Weight256.30 g/mol
Exact Mass256.11
IUPAC Name2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid
SMILESCc1cc(C)cc(-c2ccc(OCC(=O)O)cc2)c1
InChIInChI=1S/C16H16O3/c1-11-7-12(2)9-14(8-11)13-3-5-15(6-4-13)19-10-16(17)18/h3-9H,10H2,1-2H3,(H,17,18)
InChIKeyZCIWMAAGTHMUAZ-UHFFFAOYSA-N
XLogP3.43
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 53.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid?
The IUPAC name of 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid (CID 66680223) is 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid is Cc1cc(C)cc(-c2ccc(OCC(=O)O)cc2)c1.
What is the InChIKey of 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid?
The InChIKey is ZCIWMAAGTHMUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-11-7-12(2)9-14(8-11)13-3-5-15(6-4-13)19-10-16(17)18/h3-9H,10H2,1-2H3,(H,17,18).
What are the key properties of 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid?
2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid has a molecular weight of 256.30 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid is sourced from PubChem (CID 66680223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).