C16H16O3 — CID 66680223
2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid (PubChem CID 66680223) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 66680223 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid |
| SMILES | Cc1cc(C)cc(-c2ccc(OCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C16H16O3/c1-11-7-12(2)9-14(8-11)13-3-5-15(6-4-13)19-10-16(17)18/h3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | ZCIWMAAGTHMUAZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |