C14H20N2O3S — CID 177341539
methanethioamide;2-(4-methylphenoxy)acetic acid;2-methylpropanenitrile (PubChem CID 177341539) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methanethioamide;2-(4-methylphenoxy)acetic acid;2-methylpropanenitrile.
| Compound Name | methanethioamide;2-(4-methylphenoxy)acetic acid;2-methylpropanenitrile |
|---|---|
| PubChem CID | 177341539 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methanethioamide;2-(4-methylphenoxy)acetic acid;2-methylpropanenitrile |
| SMILES | CC(C)C#N.Cc1ccc(OCC(=O)O)cc1.NC=S |
| InChI | InChI=1S/C9H10O3.C4H7N.CH3NS/c1-7-2-4-8(5-3-7)12-6-9(10)11;1-4(2)3-5;2-1-3/h2-5H,6H2,1H3,(H,10,11);4H,1-2H3;1H,(H2,2,3) |
| InChIKey | GPSWTICRAPMOFG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|