C20H19NO2 — CID 160961256
1,1'-biphenyl;2-phenoxyacetamide (PubChem CID 160961256) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1,1'-biphenyl;2-phenoxyacetamide.
| Compound Name | 1,1'-biphenyl;2-phenoxyacetamide |
|---|---|
| PubChem CID | 160961256 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1,1'-biphenyl;2-phenoxyacetamide |
| SMILES | NC(=O)COc1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H9NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8(10)6-11-7-4-2-1-3-5-7/h1-10H;1-5H,6H2,(H2,9,10) |
| InChIKey | SXARGRXPMAWFCT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |