C13H14N2O5 — CID 11821934
[(2S,3S)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] acetate (PubChem CID 11821934) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is [(2S,3S)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] acetate.
| Compound Name | [(2S,3S)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] acetate |
|---|---|
| PubChem CID | 11821934 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [(2S,3S)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1NC(=O)[C@H]1NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C13H14N2O5/c1-8(16)20-13-11(12(18)15-13)14-10(17)7-19-9-5-3-2-4-6-9/h2-6,11,13H,7H2,1H3,(H,14,17)(H,15,18)/t11-,13+/m1/s1 |
| InChIKey | JOSXTSZPEJSZFT-YPMHNXCESA-N |
| XLogP | -0.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |