C14H18N2O4 — CID 67744007
N-[(2S,3S)-2-(1-methoxyethyl)-4-oxoazetidin-3-yl]-2-phenoxyacetamide (PubChem CID 67744007) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[(2S,3S)-2-(1-methoxyethyl)-4-oxoazetidin-3-yl]-2-phenoxyacetamide.
| Compound Name | N-[(2S,3S)-2-(1-methoxyethyl)-4-oxoazetidin-3-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 67744007 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(2S,3S)-2-(1-methoxyethyl)-4-oxoazetidin-3-yl]-2-phenoxyacetamide |
| SMILES | COC(C)[C@H]1NC(=O)[C@H]1NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-9(19-2)12-13(14(18)16-12)15-11(17)8-20-10-6-4-3-5-7-10/h3-7,9,12-13H,8H2,1-2H3,(H,15,17)(H,16,18)/t9?,12-,13+/m1/s1 |
| InChIKey | CXYFJINLOBDZDJ-MDGPAFOCSA-N |
| XLogP | 0.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |