About N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide
N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide (PubChem CID 54478307) has the molecular formula C31H28N2O3S
and a molecular weight of 508.64 g/mol. Its IUPAC name is N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide.
Molecular Properties
| Compound Name | N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide |
| PubChem CID | 54478307 |
| Molecular Formula | C31H28N2O3S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)N[C@@H]1C(=O)N[C@@H]1CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28N2O3S/c34-28(21-36-26-19-11-4-12-20-26)33-29-27(32-30(29)35)22-37-31(23-13-5-1-6-14-23,24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-20,27,29H,21-22H2,(H,32,35)(H,33,34)/t27-,29+/m1/s1 |
| InChIKey | XNECEHFOHGJGPA-PXJZQJOASA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide?
The IUPAC name of N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide (CID 54478307) is N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide.
What is the SMILES notation for N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide?
The canonical SMILES for N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide is O=C(COc1ccccc1)N[C@@H]1C(=O)N[C@@H]1CSC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide?
The InChIKey is XNECEHFOHGJGPA-PXJZQJOASA-N. The full InChI is InChI=1S/C31H28N2O3S/c34-28(21-36-26-19-11-4-12-20-26)33-29-27(32-30(29)35)22-37-31(23-13-5-1-6-14-23,24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-20,27,29H,21-22H2,(H,32,35)(H,33,34)/t27-,29+/m1/s1.
What are the key properties of N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide?
N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide has a molecular weight of 508.64 g/mol, XLogP of 4.77, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-2-oxo-4-(tritylsulfanylmethyl)azetidin-3-yl]-2-phenoxyacetamide is sourced from PubChem (CID 54478307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).