C17H22N2O6S — CID 54462129
tert-butyl 2-hydroxy-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-sulfanylazetidin-1-yl]acetate (PubChem CID 54462129) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-sulfanylazetidin-1-yl]acetate.
| Compound Name | tert-butyl 2-hydroxy-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-sulfanylazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 54462129 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl 2-hydroxy-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-sulfanylazetidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C(O)N1C(=O)C(NC(=O)COc2ccccc2)C1S |
| InChI | InChI=1S/C17H22N2O6S/c1-17(2,3)25-16(23)14(22)19-13(21)12(15(19)26)18-11(20)9-24-10-7-5-4-6-8-10/h4-8,12,14-15,22,26H,9H2,1-3H3,(H,18,20) |
| InChIKey | XCILNLCVMUEDHA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|