C36H35N2O6PS — CID 57099854
tert-butyl 2-[(2R,3R)-2-formylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 57099854) has the molecular formula C36H35N2O6PS and a molecular weight of 654.73 g/mol. Its IUPAC name is tert-butyl 2-[(2R,3R)-2-formylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | tert-butyl 2-[(2R,3R)-2-formylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 57099854 |
| Molecular Formula | C36H35N2O6PS |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | tert-butyl 2-[(2R,3R)-2-formylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CC(C)(C)OC(=O)C(N1C(=O)[C@@H](NC(=O)COc2ccccc2)[C@H]1SC=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35N2O6PS/c1-36(2,3)44-35(42)33(38-32(41)31(34(38)46-25-39)37-30(40)24-43-26-16-8-4-9-17-26)45(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-23,25,31,34H,24H2,1-3H3,(H,37,40)/t31-,34-/m1/s1 |
| InChIKey | YEVJPSSHEMSBGP-QIKUIUABSA-N |
| XLogP | 4.11 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|