C17H19ClN2O6 — CID 70591765
(Z)-2-[2-chloro-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-4-methoxy-3-methylbut-2-enoic acid (PubChem CID 70591765) has the molecular formula C17H19ClN2O6 and a molecular weight of 382.80 g/mol. Its IUPAC name is (Z)-2-[2-chloro-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-4-methoxy-3-methylbut-2-enoic acid.
| Compound Name | (Z)-2-[2-chloro-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-4-methoxy-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 70591765 |
| Molecular Formula | C17H19ClN2O6 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (Z)-2-[2-chloro-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-4-methoxy-3-methylbut-2-enoic acid |
| SMILES | COC/C(C)=C(/C(=O)O)N1C(=O)C(NC(=O)COc2ccccc2)C1Cl |
| InChI | InChI=1S/C17H19ClN2O6/c1-10(8-25-2)14(17(23)24)20-15(18)13(16(20)22)19-12(21)9-26-11-6-4-3-5-7-11/h3-7,13,15H,8-9H2,1-2H3,(H,19,21)(H,23,24)/b14-10- |
| InChIKey | WKAKMTPPRGKRDV-UVTDQMKNSA-N |
| XLogP | 0.96 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|