C24H25N3O9S — CID 70547191
(4-nitrophenyl)methyl (Z)-3-hydroxy-2-[2-(methoxymethylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate (PubChem CID 70547191) has the molecular formula C24H25N3O9S and a molecular weight of 531.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (Z)-3-hydroxy-2-[2-(methoxymethylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (Z)-3-hydroxy-2-[2-(methoxymethylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 70547191 |
| Molecular Formula | C24H25N3O9S |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (4-nitrophenyl)methyl (Z)-3-hydroxy-2-[2-(methoxymethylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
| SMILES | COCSC1C(NC(=O)COc2ccccc2)C(=O)N1/C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(/C)O |
| InChI | InChI=1S/C24H25N3O9S/c1-15(28)21(24(31)36-12-16-8-10-17(11-9-16)27(32)33)26-22(30)20(23(26)37-14-34-2)25-19(29)13-35-18-6-4-3-5-7-18/h3-11,20,23,28H,12-14H2,1-2H3,(H,25,29)/b21-15- |
| InChIKey | YVGKPQSQCSDMMO-QNGOZBTKSA-N |
| XLogP | 2.50 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|