C23H23N3O9S — CID 13071358
1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-3-en-2-yl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidine-2-sulfinic acid (PubChem CID 13071358) has the molecular formula C23H23N3O9S and a molecular weight of 517.52 g/mol. Its IUPAC name is 1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-3-en-2-yl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidine-2-sulfinic acid.
| Compound Name | 1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-3-en-2-yl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidine-2-sulfinic acid |
|---|---|
| PubChem CID | 13071358 |
| Molecular Formula | C23H23N3O9S |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-3-en-2-yl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidine-2-sulfinic acid |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)COc2ccccc2)C1S(=O)O |
| InChI | InChI=1S/C23H23N3O9S/c1-14(2)20(23(29)35-12-15-8-10-16(11-9-15)26(30)31)25-21(28)19(22(25)36(32)33)24-18(27)13-34-17-6-4-3-5-7-17/h3-11,19-20,22H,1,12-13H2,2H3,(H,24,27)(H,32,33) |
| InChIKey | LXKZQNQBTPSVDI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|