C23H24ClN3O7S — CID 88791526
(4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[(2-cyclohexa-1,4-dien-1-ylacetyl)amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 88791526) has the molecular formula C23H24ClN3O7S and a molecular weight of 521.98 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[(2-cyclohexa-1,4-dien-1-ylacetyl)amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[(2-cyclohexa-1,4-dien-1-ylacetyl)amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 88791526 |
| Molecular Formula | C23H24ClN3O7S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[(2-cyclohexa-1,4-dien-1-ylacetyl)amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)CC2=CCC=CC2)C1S(=O)Cl |
| InChI | InChI=1S/C23H24ClN3O7S/c1-14(2)20(23(30)34-13-16-8-10-17(11-9-16)27(31)32)26-21(29)19(22(26)35(24)33)25-18(28)12-15-6-4-3-5-7-15/h3-4,7-11,19-20,22H,1,5-6,12-13H2,2H3,(H,25,28) |
| InChIKey | QNYVBUDGNNEQEI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|