C30H26N4O7S2 — CID 151725407
(4-nitrophenyl)methyl 2-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 151725407) has the molecular formula C30H26N4O7S2 and a molecular weight of 618.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 151725407 |
| Molecular Formula | C30H26N4O7S2 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)COc2ccccc2)C1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C30H26N4O7S2/c1-18(2)26(29(37)41-16-19-12-14-20(15-13-19)34(38)39)33-27(36)25(32-24(35)17-40-21-8-4-3-5-9-21)28(33)43-30-31-22-10-6-7-11-23(22)42-30/h3-15,25-26,28H,1,16-17H2,2H3,(H,32,35) |
| InChIKey | RJLWKLZSIUATHD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|