C24H24ClN3O8S — CID 88747261
(4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[[2-(4-methylphenoxy)acetyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 88747261) has the molecular formula C24H24ClN3O8S and a molecular weight of 549.99 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[[2-(4-methylphenoxy)acetyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[[2-(4-methylphenoxy)acetyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 88747261 |
| Molecular Formula | C24H24ClN3O8S |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-chlorosulfinyl-3-[[2-(4-methylphenoxy)acetyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)COc2ccc(C)cc2)C1S(=O)Cl |
| InChI | InChI=1S/C24H24ClN3O8S/c1-14(2)21(24(31)36-12-16-6-8-17(9-7-16)28(32)33)27-22(30)20(23(27)37(25)34)26-19(29)13-35-18-10-4-15(3)5-11-18/h4-11,20-21,23H,1,12-13H2,2-3H3,(H,26,29) |
| InChIKey | OBLREOKRXINXPA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|