C24H25N3O8S — CID 22817423
(4-nitrophenyl)methyl (5S)-3,3-dimethyl-6-[[2-(4-methylphenoxy)acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22817423) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S)-3,3-dimethyl-6-[[2-(4-methylphenoxy)acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S)-3,3-dimethyl-6-[[2-(4-methylphenoxy)acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22817423 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (4-nitrophenyl)methyl (5S)-3,3-dimethyl-6-[[2-(4-methylphenoxy)acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | Cc1ccc(OCC(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)C(C)(C)S(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C24H25N3O8S/c1-14-4-10-17(11-5-14)34-13-18(28)25-19-21(29)26-20(24(2,3)36(33)22(19)26)23(30)35-12-15-6-8-16(9-7-15)27(31)32/h4-11,19-20,22H,12-13H2,1-3H3,(H,25,28)/t19?,20?,22-,36?/m0/s1 |
| InChIKey | DODYIIHGGSFGGQ-UVLOLOSBSA-N |
| XLogP | 1.59 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|