C34H31N3O6S — CID 10941074
(4-nitrophenyl)methyl (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(tritylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10941074) has the molecular formula C34H31N3O6S and a molecular weight of 609.70 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(tritylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(tritylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10941074 |
| Molecular Formula | C34H31N3O6S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S,5R,6R)-3,3-dimethyl-4,7-dioxo-6-(tritylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@@H](NC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]2[S@]1=O |
| InChI | InChI=1S/C34H31N3O6S/c1-33(2)29(32(39)43-22-23-18-20-27(21-19-23)37(40)41)36-30(38)28(31(36)44(33)42)35-34(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21,28-29,31,35H,22H2,1-2H3/t28-,29+,31-,44-/m1/s1 |
| InChIKey | GARDVYYEZFBWJZ-RQMGFCFHSA-N |
| XLogP | 4.67 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|