C24H25N3O6S — CID 70553395
(4-nitrophenyl)methyl (5R)-3,3-dimethyl-7-oxo-6-(3-phenylpropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70553395) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3,3-dimethyl-7-oxo-6-(3-phenylpropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3,3-dimethyl-7-oxo-6-(3-phenylpropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70553395 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3,3-dimethyl-7-oxo-6-(3-phenylpropanoylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2C(NC(=O)CCc3ccccc3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N3O6S/c1-24(2)20(23(30)33-14-16-8-11-17(12-9-16)27(31)32)26-21(29)19(22(26)34-24)25-18(28)13-10-15-6-4-3-5-7-15/h3-9,11-12,19-20,22H,10,13-14H2,1-2H3,(H,25,28)/t19?,20?,22-/m1/s1 |
| InChIKey | MVWYDEXVHKDYGE-QETWGEEDSA-N |
| XLogP | 2.82 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|