C15H17N3O5S — CID 12803330
(4-nitrophenyl)methyl 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 12803330) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 12803330 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (4-nitrophenyl)methyl 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)SC2C(N)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O5S/c1-15(2)11(17-12(19)10(16)13(17)24-15)14(20)23-7-8-3-5-9(6-4-8)18(21)22/h3-6,10-11,13H,7,16H2,1-2H3 |
| InChIKey | OUMGSHYLMWIHBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|