C22H24ClN3O8S2 — CID 86734113
4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2S,3S,6R,7R)-7-amino-3-chloro-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 86734113) has the molecular formula C22H24ClN3O8S2 and a molecular weight of 558.03 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2S,3S,6R,7R)-7-amino-3-chloro-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2S,3S,6R,7R)-7-amino-3-chloro-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 86734113 |
| Molecular Formula | C22H24ClN3O8S2 |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2S,3S,6R,7R)-7-amino-3-chloro-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C[C@@]1(Cl)CS[C@@H]2[C@H](N)C(=O)N2[C@H]1C(=O)OCc1ccc([N+](=O)[O-])cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H16ClN3O5S.C7H8O3S/c1-15(16)7-25-13-10(17)12(20)18(13)11(15)14(21)24-6-8-2-4-9(5-3-8)19(22)23;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,10-11,13H,6-7,17H2,1H3;2-5H,1H3,(H,8,9,10)/t10-,11+,13-,15-;/m1./s1 |
| InChIKey | BFVNZSXELDEPBH-CGYYMJHKSA-N |
| XLogP | 2.49 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|