C23H19N3O7S — CID 22820563
(4-nitrophenyl)methyl (5S)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22820563) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22820563 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (4-nitrophenyl)methyl (5S)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@H]2C(N3C(=O)c4ccccc4C3=O)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N3O7S/c1-23(2)17(22(30)33-11-12-7-9-13(10-8-12)26(31)32)25-20(29)16(21(25)34-23)24-18(27)14-5-3-4-6-15(14)19(24)28/h3-10,16-17,21H,11H2,1-2H3/t16?,17?,21-/m0/s1 |
| InChIKey | QZYFNRUGVXQDHG-BPZDKFOGSA-N |
| XLogP | 2.37 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|