C22H19Cl2N3O5S — CID 54358261
benzyl (2S,5R)-6-chloro-6-[[chloro-(4-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54358261) has the molecular formula C22H19Cl2N3O5S and a molecular weight of 508.38 g/mol. Its IUPAC name is benzyl (2S,5R)-6-chloro-6-[[chloro-(4-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R)-6-chloro-6-[[chloro-(4-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54358261 |
| Molecular Formula | C22H19Cl2N3O5S |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | benzyl (2S,5R)-6-chloro-6-[[chloro-(4-nitrophenyl)methylidene]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(Cl)N=C(Cl)c2ccc([N+](=O)[O-])cc2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N3O5S/c1-21(2)16(18(28)32-12-13-6-4-3-5-7-13)26-19(29)22(24,20(26)33-21)25-17(23)14-8-10-15(11-9-14)27(30)31/h3-11,16,20H,12H2,1-2H3/t16-,20+,22?/m0/s1 |
| InChIKey | UKQSEUGBAWTXRA-LMYOSFIVSA-N |
| XLogP | 4.32 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|