C23H21N3O7S — CID 57059021
(2S,5R)-3,3-dimethyl-6-[(4-nitrophenyl)methylideneamino]-7-oxo-6-phenylmethoxycarbonyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57059021) has the molecular formula C23H21N3O7S and a molecular weight of 483.50 g/mol. Its IUPAC name is (2S,5R)-3,3-dimethyl-6-[(4-nitrophenyl)methylideneamino]-7-oxo-6-phenylmethoxycarbonyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-3,3-dimethyl-6-[(4-nitrophenyl)methylideneamino]-7-oxo-6-phenylmethoxycarbonyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57059021 |
| Molecular Formula | C23H21N3O7S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (2S,5R)-3,3-dimethyl-6-[(4-nitrophenyl)methylideneamino]-7-oxo-6-phenylmethoxycarbonyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(/N=C/c2ccc([N+](=O)[O-])cc2)C(=O)OCc2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C23H21N3O7S/c1-22(2)17(18(27)28)25-19(29)23(20(25)34-22,21(30)33-13-15-6-4-3-5-7-15)24-12-14-8-10-16(11-9-14)26(31)32/h3-12,17,20H,13H2,1-2H3,(H,27,28)/b24-12+/t17-,20+,23?/m0/s1 |
| InChIKey | OCNLQMFWBCFSFF-UUOXUVGNSA-N |
| XLogP | 2.64 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|