C23H22N6O6S — CID 54330068
(4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 54330068) has the molecular formula C23H22N6O6S and a molecular weight of 510.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 54330068 |
| Molecular Formula | C23H22N6O6S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-[3-(benzylideneamino)-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | N[C@@H]1C(=O)N2C[C@@](C(=O)OCc3ccc([N+](=O)[O-])cc3)(N3CCN(N=Cc4ccccc4)C3=O)S[C@H]12 |
| InChI | InChI=1S/C23H22N6O6S/c24-18-19(30)26-14-23(36-20(18)26,21(31)35-13-16-6-8-17(9-7-16)29(33)34)27-10-11-28(22(27)32)25-12-15-4-2-1-3-5-15/h1-9,12,18,20H,10-11,13-14,24H2/t18-,20-,23-/m1/s1 |
| InChIKey | SXRYMIMZKXMHMQ-KKLQWCBXSA-N |
| XLogP | 1.35 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|