C19H16ClN3O5S2 — CID 139632211
(4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-(4-chlorophenyl)sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 139632211) has the molecular formula C19H16ClN3O5S2 and a molecular weight of 465.94 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-(4-chlorophenyl)sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-(4-chlorophenyl)sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 139632211 |
| Molecular Formula | C19H16ClN3O5S2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | (4-nitrophenyl)methyl (3R,5R,6R)-6-amino-3-(4-chlorophenyl)sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | N[C@@H]1C(=O)N2C[C@](Sc3ccc(Cl)cc3)(C(=O)OCc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C19H16ClN3O5S2/c20-12-3-7-14(8-4-12)29-19(10-22-16(24)15(21)17(22)30-19)18(25)28-9-11-1-5-13(6-2-11)23(26)27/h1-8,15,17H,9-10,21H2/t15-,17-,19-/m1/s1 |
| InChIKey | DTQPYQJRQBLEQV-SZVBFZGTSA-N |
| XLogP | 3.02 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|