C14H14ClN3O5S — CID 70362168
(4-nitrophenyl)methyl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride (PubChem CID 70362168) has the molecular formula C14H14ClN3O5S and a molecular weight of 371.80 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70362168 |
| Molecular Formula | C14H14ClN3O5S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
| SMILES | Cl.NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@@H]12 |
| InChI | InChI=1S/C14H13N3O5S.ClH/c15-11-12(18)16-10(5-6-23-13(11)16)14(19)22-7-8-1-3-9(4-2-8)17(20)21;/h1-5,11,13H,6-7,15H2;1H/t11?,13-;/m0./s1 |
| InChIKey | QCUWDJVZLFMUIZ-IYWIJXFJSA-N |
| XLogP | 1.19 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|