C15H15N3O8S2 — CID 88729380
(4-nitrophenyl)methyl (6R)-7-amino-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88729380) has the molecular formula C15H15N3O8S2 and a molecular weight of 429.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-amino-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-amino-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88729380 |
| Molecular Formula | C15H15N3O8S2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-amino-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CS(=O)(=O)OC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(N)[C@H]2SC1 |
| InChI | InChI=1S/C15H15N3O8S2/c1-28(23,24)26-10-7-27-14-11(16)13(19)17(14)12(10)15(20)25-6-8-2-4-9(5-3-8)18(21)22/h2-5,11,14H,6-7,16H2,1H3/t11?,14-/m1/s1 |
| InChIKey | NTRGZNRMYOZROF-SBXXRYSUSA-N |
| XLogP | 0.07 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|