C17H17N3O9S2 — CID 88815861
(4-nitrophenyl)methyl (6R)-7-acetamido-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88815861) has the molecular formula C17H17N3O9S2 and a molecular weight of 471.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-acetamido-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-acetamido-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88815861 |
| Molecular Formula | C17H17N3O9S2 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-acetamido-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OS(C)(=O)=O)CS[C@H]12 |
| InChI | InChI=1S/C17H17N3O9S2/c1-9(21)18-13-15(22)19-14(12(8-30-16(13)19)29-31(2,26)27)17(23)28-7-10-3-5-11(6-4-10)20(24)25/h3-6,13,16H,7-8H2,1-2H3,(H,18,21)/t13?,16-/m1/s1 |
| InChIKey | WTLFNHOYDNKXES-FQNRMIAFSA-N |
| XLogP | 0.25 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|