C24H22N4O8S — CID 54079747
(4-nitrophenyl)methyl (6S)-3-(carbamoyloxymethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54079747) has the molecular formula C24H22N4O8S and a molecular weight of 526.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-3-(carbamoyloxymethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-3-(carbamoyloxymethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54079747 |
| Molecular Formula | C24H22N4O8S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-3-(carbamoyloxymethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | NC(=O)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)Cc3ccccc3)[C@@H]2SC1 |
| InChI | InChI=1S/C24H22N4O8S/c25-24(32)36-12-16-13-37-22-19(26-18(29)10-14-4-2-1-3-5-14)21(30)27(22)20(16)23(31)35-11-15-6-8-17(9-7-15)28(33)34/h1-9,19,22H,10-13H2,(H2,25,32)(H,26,29)/t19?,22-/m0/s1 |
| InChIKey | MMGCDBTVMYRPMW-BPARTEKVSA-N |
| XLogP | 1.63 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|