C26H26N4O7S — CID 54116311
(4-nitrophenyl)methyl (6S)-3-morpholin-4-yl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54116311) has the molecular formula C26H26N4O7S and a molecular weight of 538.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-3-morpholin-4-yl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-3-morpholin-4-yl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54116311 |
| Molecular Formula | C26H26N4O7S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-3-morpholin-4-yl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(N3CCOCC3)CS[C@@H]12 |
| InChI | InChI=1S/C26H26N4O7S/c31-21(14-17-4-2-1-3-5-17)27-22-24(32)29-23(20(16-38-25(22)29)28-10-12-36-13-11-28)26(33)37-15-18-6-8-19(9-7-18)30(34)35/h1-9,22,25H,10-16H2,(H,27,31)/t22?,25-/m0/s1 |
| InChIKey | NKOWXFPEYXERPE-TUXUZCGSSA-N |
| XLogP | 1.82 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|