C20H16ClN3O6S2 — CID 12918654
(4-nitrophenyl)methyl (6R,7R)-3-chloro-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 12918654) has the molecular formula C20H16ClN3O6S2 and a molecular weight of 493.95 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R,7R)-3-chloro-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R,7R)-3-chloro-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 12918654 |
| Molecular Formula | C20H16ClN3O6S2 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | (4-nitrophenyl)methyl (6R,7R)-3-chloro-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1cccs1)N[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(Cl)CS[C@H]12 |
| InChI | InChI=1S/C20H16ClN3O6S2/c21-14-10-32-19-16(22-15(25)8-13-2-1-7-31-13)18(26)23(19)17(14)20(27)30-9-11-3-5-12(6-4-11)24(28)29/h1-7,16,19H,8-10H2,(H,22,25)/t16-,19-/m1/s1 |
| InChIKey | MJSLXMHHSSCUOK-VQIMIIECSA-N |
| XLogP | 2.79 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|