C24H22N4O7S2 — CID 131714475
(4-nitrophenyl)methyl (6R,7R)-8-oxo-3-(oxolan-2-ylideneamino)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131714475) has the molecular formula C24H22N4O7S2 and a molecular weight of 542.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R,7R)-8-oxo-3-(oxolan-2-ylideneamino)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R,7R)-8-oxo-3-(oxolan-2-ylideneamino)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131714475 |
| Molecular Formula | C24H22N4O7S2 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (4-nitrophenyl)methyl (6R,7R)-8-oxo-3-(oxolan-2-ylideneamino)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1cccs1)N[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(/N=C3\CCCO3)CS[C@H]12 |
| InChI | InChI=1S/C24H22N4O7S2/c29-18(11-16-3-2-10-36-16)26-20-22(30)27-21(17(13-37-23(20)27)25-19-4-1-9-34-19)24(31)35-12-14-5-7-15(8-6-14)28(32)33/h2-3,5-8,10,20,23H,1,4,9,11-13H2,(H,26,29)/b25-19+/t20-,23-/m1/s1 |
| InChIKey | PDEVORWNAXDYFL-KYAQNKNXSA-N |
| XLogP | 2.76 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|