C23H19N3O9S — CID 88824018
(4-nitrophenyl)methyl (6R)-7-[[2-(2-formyloxyphenyl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88824018) has the molecular formula C23H19N3O9S and a molecular weight of 513.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[2-(2-formyloxyphenyl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-formyloxyphenyl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88824018 |
| Molecular Formula | C23H19N3O9S |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-formyloxyphenyl)acetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=COc1ccccc1CC(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS[C@H]12 |
| InChI | InChI=1S/C23H19N3O9S/c27-12-35-17-4-2-1-3-14(17)9-18(29)24-19-21(30)25-20(16(28)11-36-22(19)25)23(31)34-10-13-5-7-15(8-6-13)26(32)33/h1-8,12,19,22,28H,9-11H2,(H,24,29)/t19?,22-/m1/s1 |
| InChIKey | HEDJJXPNYGLVNV-AVKWCDSFSA-N |
| XLogP | 1.59 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|