C22H15N3O8S — CID 70614811
(4-nitrophenyl)methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70614811) has the molecular formula C22H15N3O8S and a molecular weight of 481.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70614811 |
| Molecular Formula | C22H15N3O8S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=C(O)CS[C@H]2C(N3C(=O)c4ccccc4C3=O)C(=O)N12 |
| InChI | InChI=1S/C22H15N3O8S/c26-15-10-34-21-17(23-18(27)13-3-1-2-4-14(13)19(23)28)20(29)24(21)16(15)22(30)33-9-11-5-7-12(8-6-11)25(31)32/h1-8,17,21,26H,9-10H2/t17?,21-/m0/s1 |
| InChIKey | XPVOGXOWTJMBLJ-LFABVHOISA-N |
| XLogP | 1.99 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|