C24H23N3O9S — CID 70627519
(4-nitrophenyl)methyl (6R)-7-[(2,6-dimethoxybenzoyl)amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70627519) has the molecular formula C24H23N3O9S and a molecular weight of 529.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[(2,6-dimethoxybenzoyl)amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[(2,6-dimethoxybenzoyl)amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70627519 |
| Molecular Formula | C24H23N3O9S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[(2,6-dimethoxybenzoyl)amino]-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)c3c(OC)cccc3OC)[C@H]2SC1 |
| InChI | InChI=1S/C24H23N3O9S/c1-33-15-5-4-6-16(34-2)18(15)21(28)25-19-22(29)26-20(17(35-3)12-37-23(19)26)24(30)36-11-13-7-9-14(10-8-13)27(31)32/h4-10,19,23H,11-12H2,1-3H3,(H,25,28)/t19?,23-/m1/s1 |
| InChIKey | HDRUHWYYQNPVQA-LEQGEALCSA-N |
| XLogP | 2.23 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|