C24H21N3O9S2 — CID 70542412
(4-nitrophenyl)methyl (4Z,6R)-3-(acetyloxymethyl)-4-(hydroxymethylidene)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70542412) has the molecular formula C24H21N3O9S2 and a molecular weight of 559.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4Z,6R)-3-(acetyloxymethyl)-4-(hydroxymethylidene)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4Z,6R)-3-(acetyloxymethyl)-4-(hydroxymethylidene)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70542412 |
| Molecular Formula | C24H21N3O9S2 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | (4-nitrophenyl)methyl (4Z,6R)-3-(acetyloxymethyl)-4-(hydroxymethylidene)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)Cc3cccs3)[C@H]2S/C1=C\O |
| InChI | InChI=1S/C24H21N3O9S2/c1-13(29)35-12-17-18(10-28)38-23-20(25-19(30)9-16-3-2-8-37-16)22(31)26(23)21(17)24(32)36-11-14-4-6-15(7-5-14)27(33)34/h2-8,10,20,23,28H,9,11-12H2,1H3,(H,25,30)/b18-10-/t20?,23-/m1/s1 |
| InChIKey | RBGXSMKRZSTRDN-CTIZZNRCSA-N |
| XLogP | 2.56 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|