C27H23N3O11S — CID 150533723
(4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-4-(formyloxymethylidene)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 150533723) has the molecular formula C27H23N3O11S and a molecular weight of 597.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-4-(formyloxymethylidene)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-4-(formyloxymethylidene)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 150533723 |
| Molecular Formula | C27H23N3O11S |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-4-(formyloxymethylidene)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)COc3ccccc3)[C@H]2SC1=COC=O |
| InChI | InChI=1S/C27H23N3O11S/c1-16(32)39-12-20-21(13-38-15-31)42-26-23(28-22(33)14-40-19-5-3-2-4-6-19)25(34)29(26)24(20)27(35)41-11-17-7-9-18(10-8-17)30(36)37/h2-10,13,15,23,26H,11-12,14H2,1H3,(H,28,33)/t23?,26-/m1/s1 |
| InChIKey | IEJTYXGOZUORKH-ANWICMFUSA-N |
| XLogP | 1.95 |
| TPSA | 180.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|