C25H23N3O10S — CID 22798048
(4-nitrophenyl)methyl (6S)-3-(acetyloxymethyl)-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22798048) has the molecular formula C25H23N3O10S and a molecular weight of 557.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-3-(acetyloxymethyl)-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-3-(acetyloxymethyl)-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22798048 |
| Molecular Formula | C25H23N3O10S |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-3-(acetyloxymethyl)-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)COc3ccccc3)[C@@H]2S(=O)C1 |
| InChI | InChI=1S/C25H23N3O10S/c1-15(29)36-12-17-14-39(35)24-21(26-20(30)13-37-19-5-3-2-4-6-19)23(31)27(24)22(17)25(32)38-11-16-7-9-18(10-8-16)28(33)34/h2-10,21,24H,11-14H2,1H3,(H,26,30)/t21?,24-,39?/m0/s1 |
| InChIKey | TVXKLTSZORFFAJ-LHCUUUFGSA-N |
| XLogP | 0.95 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|