C25H22BrN3O7S — CID 70543068
(4-nitrophenyl)methyl (4E,6R)-4-(1-bromoethylidene)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70543068) has the molecular formula C25H22BrN3O7S and a molecular weight of 588.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4E,6R)-4-(1-bromoethylidene)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4E,6R)-4-(1-bromoethylidene)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70543068 |
| Molecular Formula | C25H22BrN3O7S |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 587.04 |
| IUPAC Name | (4-nitrophenyl)methyl (4E,6R)-4-(1-bromoethylidene)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)COc3ccccc3)[C@H]2S/C1=C(\C)Br |
| InChI | InChI=1S/C25H22BrN3O7S/c1-14-21(25(32)36-12-16-8-10-17(11-9-16)29(33)34)28-23(31)20(24(28)37-22(14)15(2)26)27-19(30)13-35-18-6-4-3-5-7-18/h3-11,20,24H,12-13H2,1-2H3,(H,27,30)/b22-15+/t20?,24-/m1/s1 |
| InChIKey | FSNVHRARMMFPSB-AWAQWICYSA-N |
| XLogP | 4.02 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|