C15H13N3O7S — CID 70491940
(6R)-7-amino-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70491940) has the molecular formula C15H13N3O7S and a molecular weight of 379.35 g/mol. Its IUPAC name is (6R)-7-amino-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-amino-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70491940 |
| Molecular Formula | C15H13N3O7S |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (6R)-7-amino-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC1C(=O)N2C(C(=O)O)=C(COC(=O)c3ccc([N+](=O)[O-])cc3)CS[C@H]12 |
| InChI | InChI=1S/C15H13N3O7S/c16-10-12(19)17-11(14(20)21)8(6-26-13(10)17)5-25-15(22)7-1-3-9(4-2-7)18(23)24/h1-4,10,13H,5-6,16H2,(H,20,21)/t10?,13-/m1/s1 |
| InChIKey | KZWYLELTUBEOML-JLOHTSLTSA-N |
| XLogP | 0.33 |
| TPSA | 153.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|