C22H21N3O6S2 — CID 159327798
(4-methoxyphenyl)methyl 7-amino-3-[(4-nitrophenyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 159327798) has the molecular formula C22H21N3O6S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 7-amino-3-[(4-nitrophenyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 7-amino-3-[(4-nitrophenyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 159327798 |
| Molecular Formula | C22H21N3O6S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (4-methoxyphenyl)methyl 7-amino-3-[(4-nitrophenyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(CSc3ccc([N+](=O)[O-])cc3)CSC3C(N)C(=O)N23)cc1 |
| InChI | InChI=1S/C22H21N3O6S2/c1-30-16-6-2-13(3-7-16)10-31-22(27)19-14(12-33-21-18(23)20(26)24(19)21)11-32-17-8-4-15(5-9-17)25(28)29/h2-9,18,21H,10-12,23H2,1H3 |
| InChIKey | LEOXOICLDJLUKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|