C24H19N7O7S2 — CID 13138054
(4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-phenoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 13138054) has the molecular formula C24H19N7O7S2 and a molecular weight of 581.59 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-phenoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-phenoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 13138054 |
| Molecular Formula | C24H19N7O7S2 |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-phenoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N/Oc2ccccc2)C(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)=CCS[C@H]23)ns1 |
| InChI | InChI=1S/C24H19N7O7S2/c25-24-27-19(29-40-24)17(28-38-15-4-2-1-3-5-15)20(32)26-18-21(33)30-16(10-11-39-22(18)30)23(34)37-12-13-6-8-14(9-7-13)31(35)36/h1-10,18,22H,11-12H2,(H,26,32)(H2,25,27,29)/b28-17-/t18?,22-/m1/s1 |
| InChIKey | QTELWOZROZACHT-XKKLOVGKSA-N |
| XLogP | 1.84 |
| TPSA | 192.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|