C22H20N6O7S — CID 88675512
(4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(4-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88675512) has the molecular formula C22H20N6O7S and a molecular weight of 512.50 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(4-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(4-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88675512 |
| Molecular Formula | C22H20N6O7S |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(4-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@H]12)c1cc(N)ccn1 |
| InChI | InChI=1S/C22H20N6O7S/c1-34-26-17(15-10-13(23)6-8-24-15)19(29)25-18-20(30)27-16(7-9-36-21(18)27)22(31)35-11-12-2-4-14(5-3-12)28(32)33/h2-8,10,18,21H,9,11H2,1H3,(H2,23,24)(H,25,29)/b26-17-/t18?,21-/m1/s1 |
| InChIKey | GFHOZNUJGJXOFX-OVXSRVEMSA-N |
| XLogP | 0.95 |
| TPSA | 179.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|