C19H17N7O7S2 — CID 88676723
(4-nitrophenyl)methyl (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88676723) has the molecular formula C19H17N7O7S2 and a molecular weight of 519.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88676723 |
| Molecular Formula | C19H17N7O7S2 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C19H17N7O7S2/c1-32-23-12(14-22-19(20)35-24-14)15(27)21-13-16(28)25-11(6-7-34-17(13)25)18(29)33-8-9-2-4-10(5-3-9)26(30)31/h2-6,13,17H,7-8H2,1H3,(H,21,27)(H2,20,22,24)/t13?,17-/m0/s1 |
| InChIKey | ZENCWSWGANEHEO-RUINGEJQSA-N |
| XLogP | 0.41 |
| TPSA | 192.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|