C26H22N6O7S2 — CID 88689877
(4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88689877) has the molecular formula C26H22N6O7S2 and a molecular weight of 594.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88689877 |
| Molecular Formula | C26H22N6O7S2 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N/OCc2ccccc2)C(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)=CCS[C@H]23)cs1 |
| InChI | InChI=1S/C26H22N6O7S2/c27-26-28-18(14-41-26)20(30-39-13-15-4-2-1-3-5-15)22(33)29-21-23(34)31-19(10-11-40-24(21)31)25(35)38-12-16-6-8-17(9-7-16)32(36)37/h1-10,14,21,24H,11-13H2,(H2,27,28)(H,29,33)/b30-20-/t21?,24-/m1/s1 |
| InChIKey | DIBOURNJULZJGH-YNZTZMCASA-N |
| XLogP | 2.58 |
| TPSA | 179.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|