C21H21N7O7S2 — CID 154413847
(4-nitrophenyl)methyl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154413847) has the molecular formula C21H21N7O7S2 and a molecular weight of 547.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413847 |
| Molecular Formula | C21H21N7O7S2 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-propan-2-yloxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(C)ON=C(C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C21H21N7O7S2/c1-10(2)35-25-14(16-24-21(22)37-26-16)17(29)23-15-18(30)27-13(7-8-36-19(15)27)20(31)34-9-11-3-5-12(6-4-11)28(32)33/h3-7,10,15,19H,8-9H2,1-2H3,(H,23,29)(H2,22,24,26)/t15?,19-/m1/s1 |
| InChIKey | VGKIJMWWLZEFBE-XCWJXAQQSA-N |
| XLogP | 1.18 |
| TPSA | 192.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|